Drugs present in MMsINC which are similar to the molecule MMscode: MMs00472457
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.81 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.81 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.73 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.71 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.71 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |
MMs01725336 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |
MMs01726821 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.71 |
MMs01726823 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.71 |
MMs01726825 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.71 |
MMs01725689 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.71 |
MMs01724925 | O=C1NCNC(=O)C1(CC)c1ccccc1 | 0.70 |
MMs01727287 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |