Drugs present in MMsINC which are similar to the molecule MMscode: MMs00464148
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726673 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.79 |
MMs01725949 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.79 |
MMs01726669 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.79 |
MMs01726671 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.79 |
MMs01727451 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.74 |
MMs01727455 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.74 |
MMs01727453 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.74 |
MMs01727291 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.74 |
MMs01727289 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.74 |
MMs01727293 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.74 |
MMs01727295 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.74 |
MMs01727449 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.74 |
MMs01727422 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01725811 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01725851 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01727424 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.71 |
MMs01726973 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01725777 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01726971 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |