Drugs present in MMsINC which are similar to the molecule MMscode: MMs00456093
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725779![]() | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.73 |
MMs01725098![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.72 |
MMs01725416![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.72 |
MMs01724786![]() | O1CCN(CC1)CC1CCc2[nH]c(C)c(c2C1=O)CC | 0.71 |
MMs01725141![]() | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.70 |