Drugs present in MMsINC which are similar to the molecule MMscode: MMs00456056
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.76 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01724760 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.72 |
MMs01725155 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.72 |
MMs01725156 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.72 |
MMs01725091 | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)C | 0.71 |