Drugs present in MMsINC which are similar to the molecule MMscode: MMs00438236
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.81 |
MMs01725336 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.81 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.78 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.78 |
MMs01725672 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.74 |
MMs01725798 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.74 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.73 |
MMs01724890 | O=C1N(N(C(=O)C1CC=C(C)C)c1ccccc1)c1ccccc1 | 0.72 |
MMs01725425 | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.72 |
MMs01727468 | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.70 |
MMs01724782 | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.70 |
MMs01725932 | O(CC(C)C)CC(N1CCCC1)CN(Cc1ccccc1)c1ccccc1 | 0.70 |
MMs01726073 | O(CC(C)C)CC(N1CCCC1)CN(Cc1ccccc1)c1ccccc1 | 0.70 |