Drugs present in MMsINC which are similar to the molecule MMscode: MMs00416363
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.84 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.84 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.83 |
MMs01724764 | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.82 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.82 |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.82 |
MMs01725087 | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.81 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.80 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.80 |
MMs01726108 | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.79 |
MMs01726106 | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.79 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.75 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.75 |
MMs01725547 | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.74 |
MMs01725185 | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.73 |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.73 |
MMs01725118 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)CCN1CCCCC1 | 0.72 |
MMs01724770 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CCC[N+](C1)(C)C | 0.70 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.70 |
MMs01725753 | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.70 |