Drugs present in MMsINC which are similar to the molecule MMscode: MMs00352633
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.76 |
MMs01724727![]() | Brc1ccc(cc1)C(OCCN(C)C)c1ccccc1 | 0.73 |
MMs01725547![]() | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.73 |
MMs01724737![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.73 |
MMs01725786![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.73 |
MMs01724775![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.72 |
MMs01725049![]() | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.72 |