Drugs present in MMsINC which are similar to the molecule MMscode: MMs00320185
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724991![]() | [NH+](CCc1c2cc(ccc2[nH]c1)Cn1ncnc1)(C)C | 0.76 |
MMs01726741![]() | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.75 |
MMs01724945![]() | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.72 |
MMs01726906![]() | O=C(NC1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)N(CC)CC | 0.71 |
MMs01726908![]() | O=C(NC1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)N(CC)CC | 0.71 |
MMs01725411![]() | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.70 |