Drugs present in MMsINC which are similar to the molecule MMscode: MMs00314311
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724890![]() | O=C1N(N(C(=O)C1CC=C(C)C)c1ccccc1)c1ccccc1 | 0.80 |
MMs01725798![]() | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.78 |
MMs01725672![]() | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.78 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.74 |
MMs01725217![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(N2c3c(NC2=O)cccc3)=CC1 | 0.73 |
MMs01724773![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.73 |
MMs01725110![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.73 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.72 |
MMs01725336![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.72 |
MMs01727468![]() | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.72 |
MMs01724833![]() | FCC1=Nc2c(cc(N)cc2)C(=O)N1c1ccccc1C | 0.72 |
MMs01725683![]() | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.71 |
MMs01725685![]() | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.71 |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.71 |
MMs01725425![]() | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.71 |
MMs01724876![]() | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.70 |