Drugs present in MMsINC which are similar to the molecule MMscode: MMs00291183
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725251 | O=C1N(C)C(=O)N(c2nc(n(c12)CCN(CCO)CC)Cc1ccccc1)C | 0.78 |
MMs01725766 | Oc1cc(cc(O)c1)C(O)CNCCCn1c2c(nc1)N(C)C(=O)N(C)C2=O | 0.76 |
MMs01724964 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.72 |
MMs01725125 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.72 |
MMs01725127 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.72 |