Drugs present in MMsINC which are similar to the molecule MMscode: MMs00283200
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724819 | s1cccc1C(c1sccc1)=C1CCC[NH+](C1)C | 0.75 |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.71 |
MMs01724829 | s1c2c(cc1C(N(O)C(=O)N)C)cccc2 | 0.71 |
MMs01725182 | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.70 |
MMs01727430 | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.70 |