Drugs present in MMsINC which are similar to the molecule MMscode: MMs00239188
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726741 | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.77 |
MMs01725089 | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.76 |
MMs01724834 | Clc1cc2c(-n3c(nnc3C)CN=C2c2ccccc2)cc1 | 0.72 |
MMs01724884 | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.71 |
MMs01724865 | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.71 |