Drugs present in MMsINC which are similar to the molecule MMscode: MMs00234775
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.77 |
MMs01725495 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.72 |
MMs01725497 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.72 |
MMs01725499 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.72 |
MMs01725501 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.72 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.70 |