Drugs present in MMsINC which are similar to the molecule MMscode: MMs00229698
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.72 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.72 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.72 |
MMs01725401 | S1C(Cc2ccc(OCC3(Oc4c(CC3)c(C)c(O)c(C)c4C)C)cc2)C(=O)NC1=O | 0.71 |
MMs01725402 | S1C(Cc2ccc(OCC3(Oc4c(CC3)c(C)c(O)c(C)c4C)C)cc2)C(=O)NC1=O | 0.71 |
MMs01725403 | S1C(Cc2ccc(OCC3(Oc4c(CC3)c(C)c(O)c(C)c4C)C)cc2)C(=O)NC1=O | 0.71 |
MMs01725404 | S1C(Cc2ccc(OCC3(Oc4c(CC3)c(C)c(O)c(C)c4C)C)cc2)C(=O)NC1=O | 0.71 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.71 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.71 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.71 |