Drugs present in MMsINC which are similar to the molecule MMscode: MMs00226560
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.72 |
MMs01725361 | O1Cc2c(cccc2)/C(/c2cc(ccc12)CC(O)=O)=C\CCN(C)C | 0.72 |
MMs01724919 | O(CCN(C)C)c1ccccc1Cc1ccccc1 | 0.71 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |
MMs01725084 | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.71 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.70 |
MMs01725375 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.70 |