Drugs present in MMsINC which are similar to the molecule MMscode: MMs00198263
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725227![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.71 |
MMs01725853![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.71 |
MMs01725233![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.71 |
MMs01725799![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.71 |
MMs01725237![]() | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.70 |