Drugs present in MMsINC which are similar to the molecule MMscode: MMs00190351
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724841![]() | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.82 |
MMs01727166![]() | O1C(C)(C)C(OC)C(OC(=O)N)C(O)C1Oc1ccc2c(OC(=O)C(NC(=O)c3cc(CC=C(C)C)c(O)cc3)=C2O)c1C | 0.75 |
MMs01727167![]() | O1C(C)(C)C(OC)C(OC(=O)N)C(O)C1Oc1ccc2c(OC(=O)C(NC(=O)c3cc(CC=C(C)C)c(O)cc3)=C2O)c1C | 0.75 |
MMs01727164![]() | O1C(C)(C)C(OC)C(OC(=O)N)C(O)C1Oc1ccc2c(OC(=O)C(NC(=O)c3cc(CC=C(C)C)c(O)cc3)=C2O)c1C | 0.75 |
MMs01727165![]() | O1C(C)(C)C(OC)C(OC(=O)N)C(O)C1Oc1ccc2c(OC(=O)C(NC(=O)c3cc(CC=C(C)C)c(O)cc3)=C2O)c1C | 0.75 |
MMs01727463![]() | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.74 |
MMs01725187![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.73 |
MMs01724733![]() | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.70 |