Drugs present in MMsINC which are similar to the molecule MMscode: MMs00176390
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.78 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.74 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.70 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.70 |