Drugs present in MMsINC which are similar to the molecule MMscode: MMs00170552
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725766 | Oc1cc(cc(O)c1)C(O)CNCCCn1c2c(nc1)N(C)C(=O)N(C)C2=O | 0.75 |
MMs01724827 | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)CN(CCO)C)C | 0.73 |
MMs01725082 | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)C)C | 0.73 |
MMs01725083 | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)C)C | 0.73 |
MMs01725175 | Clc1ccc(OC(C(OCCn2c3c(nc2)N(C)C(=O)N(C)C3=O)=O)(C)C)cc1 | 0.70 |