Drugs present in MMsINC which are similar to the molecule MMscode: MMs00157671
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725202 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.74 |
MMs01725192 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.74 |
MMs01727028 | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.74 |
MMs01727029 | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.74 |
MMs01727030 | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.74 |
MMs01725198 | O(C(=O)C=1C(C(C(OC)=O)C(=NC=1C)C)c1cc([N+](=O)[O-])ccc1)CC | 0.73 |
MMs01727142 | O(C(=O)C1C(C(C(OC)=O)C(=NC1=C)C)c1ccccc1[N+](=O)[O-])CC(C)C | 0.71 |