Drugs present in MMsINC which are similar to the molecule MMscode: MMs00126883
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725193 | S(=O)(=O)(CC(O)(C(=O)Nc1cc(C(F)(F)F)c(cc1)C#N)C)c1ccc(F)cc1 | 0.80 |
MMs01725378 | S(=O)(=O)(CC(O)(C(=O)Nc1cc(C(F)(F)F)c(cc1)C#N)C)c1ccc(F)cc1 | 0.80 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.74 |
MMs01727381 | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.74 |
MMs01725425 | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.72 |
MMs01725059 | S1c2c(N(c3c1cccc3)CCCN(C)C)cc(cc2)C(=O)C | 0.71 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |
MMs01724823 | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.71 |
MMs01724810 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.70 |
MMs01724778 | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.70 |