Drugs present in MMsINC which are similar to the molecule MMscode: MMs00102101
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724724![]() | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.82 |
MMs01725708![]() | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.82 |
MMs01725779![]() | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.77 |
MMs01724881![]() | o1c(c(nc1N(CCO)CCO)-c1ccccc1)-c1ccccc1 | 0.74 |
MMs01724841![]() | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.71 |