Drugs present in MMsINC which are similar to the molecule MMscode: MMs00089257
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724752 | O(C(=O)C1(CCCN(CC1)C)c1ccccc1)CC | 0.73 |
MMs01725640 | O(C(=O)C1(CCCN(CC1)C)c1ccccc1)CC | 0.73 |
MMs01725231 | OC(=O)C1(CCN(CC1)CCC(C#N)(c1ccccc1)c1ccccc1)c1ccccc1 | 0.72 |
MMs01726642 | O(C(=O)C1(CCN(CC1)CCC(C#N)(c1ccccc1)c1ccccc1)c1ccccc1)CC | 0.72 |
MMs01724901 | O(C(=O)C1(CCN(CC1)C)c1ccccc1)CC | 0.71 |
MMs01725235 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.71 |