Drugs present in MMsINC which are similar to the molecule MMscode: MMs00084149
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.81 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.77 |
MMs01725033 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725065 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725067 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725593 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.71 |
MMs01725592 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.71 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |