Drugs present in MMsINC which are similar to the molecule MMscode: MMs00083858
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.75 |
MMs01724839 | Oc1ncc(cc1N)-c1ccncc1 | 0.73 |
MMs01727387 | S(=O)(=O)(Nc1ncccc1)c1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1 | 0.72 |
MMs01725821 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.72 |
MMs01725790 | OC(=O)C(NC(=O)c1ccc(NCc2nc3c(nc(nc3N)N)nc2)cc1)CCC(O)=O | 0.71 |
MMs01725860 | OC(=O)\C=C\c1nc(ccc1)/C(=C\CN1CCCC1)/c1ccc(cc1)C | 0.71 |
MMs01725449 | OC(=O)C(NC(=O)c1ccc(N(Cc2nc3c(nc(nc3N)N)nc2)C)cc1)CCC(O)=O | 0.70 |
MMs01725096 | Clc1ccc(cc1)C(=O)c1n(C)c(cc1C)CC(O)=O | 0.70 |