Drugs present in MMsINC which are similar to the molecule MMscode: MMs00078154
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724819 | s1cccc1C(c1sccc1)=C1CCC[NH+](C1)C | 0.73 |
MMs01726782 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.71 |
MMs01726784 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.71 |
MMs01725501 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.71 |
MMs01725499 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.71 |
MMs01725495 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.71 |
MMs01725497 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.71 |