Drugs present in MMsINC which are similar to the molecule MMscode: MMs00056869
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.74 |
MMs01726866![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.74 |
MMs01726865![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.74 |
MMs01725747![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.72 |
MMs01725749![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.72 |
MMs01724873![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.72 |
MMs01725745![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.72 |
MMs01725448![]() | Oc1cc(ccc1O)CC(N)C(O)=O | 0.72 |