Drugs present in MMsINC which are similar to the molecule MMscode: MMs00054955
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.75 |
MMs01725588 | Clc1cc(N)ccc1C(OCCN(CC)CC)=O | 0.75 |
MMs01724806 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.73 |
MMs01725741 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.73 |
MMs01726609 | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.72 |
MMs01726849 | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.72 |
MMs01724905 | S1c2c(N(c3c1cccc3)C)cc(cc2)CC(O)=O | 0.71 |
MMs01726878 | Ic1c(C(=O)NC)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.70 |