Drugs present in MMsINC which are similar to the molecule MMscode: MMs00051139
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726865![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.81 |
MMs01726866![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.81 |
MMs01727470![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.74 |
MMs01727472![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.74 |
MMs01724849![]() | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.73 |







