Drugs present in MMsINC which are similar to the molecule MMscode: MMs00050021
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726868![]() | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.73 |
MMs01726869![]() | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.73 |
MMs01726870![]() | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.73 |
MMs01726871![]() | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.73 |
MMs01726872![]() | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.73 |