Drugs present in MMsINC which are similar to the molecule MMscode: MMs00044616
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727365![]() | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.76 |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.71 |
MMs01726454![]() | O1C(C(O)C(O)C(O)C1CO)c1c(O)c(O)c2c(c1O)C(=O)c1c(cc(O)c(C(O)=O)c1C)C2=O | 0.71 |
MMs01726452![]() | O1C(C(O)C(O)C(O)C1CO)c1c(O)c(O)c2c(c1O)C(=O)c1c(cc(O)c(C(O)=O)c1C)C2=O | 0.71 |
MMs01726456![]() | O1C(C(O)C(O)C(O)C1CO)c1c(O)c(O)c2c(c1O)C(=O)c1c(cc(O)c(C(O)=O)c1C)C2=O | 0.71 |
MMs01726458![]() | O1C(C(O)C(O)C(O)C1CO)c1c(O)c(O)c2c(c1O)C(=O)c1c(cc(O)c(C(O)=O)c1C)C2=O | 0.71 |
MMs01724767![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.71 |
MMs01725139![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.71 |
MMs01725137![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.71 |
MMs01727079![]() | O1c2c(C3C(CCC(=O)C3)C1(C)C)c(O)cc(c2)C(CCCCCC)(C)C | 0.71 |
MMs01727081![]() | O1c2c(C3C(CCC(=O)C3)C1(C)C)c(O)cc(c2)C(CCCCCC)(C)C | 0.71 |
MMs01727080![]() | O1c2c(C3C(CCC(=O)C3)C1(C)C)c(O)cc(c2)C(CCCCCC)(C)C | 0.71 |
MMs01725781![]() | O1c2c(C(=O)C(O)C1c1cc3OC(C(Oc3cc1)CO)c1cc(OC)c(O)cc1)c(O)cc(O)c2 | 0.70 |