Drugs present in MMsINC which are similar to the molecule MMscode: MMs00042911
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727365 | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.79 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.78 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.78 |
MMs01726594 | FC12C(C3CC(C)C(OC(=O)c4occc4)(C(=O)COC(=O)C)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.72 |
MMs01726596 | FC12C(C3CC(C)C(OC(=O)c4occc4)(C(=O)COC(=O)C)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.72 |
MMs01726597 | FC12C(C3CC(C)C(OC(=O)c4occc4)(C(=O)COC(=O)C)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.72 |
MMs01725781 | O1c2c(C(=O)C(O)C1c1cc3OC(C(Oc3cc1)CO)c1cc(OC)c(O)cc1)c(O)cc(O)c2 | 0.72 |