Drugs present in MMsINC which are similar to the molecule MMscode: MMs00039155
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725405![]() | O=C1NC(=O)NC(=O)C1(C(CCC)C)CC | 0.73 |
MMs01725368![]() | O=C1NC(=O)NC(=O)C1(C(CC)C)CC | 0.73 |
MMs01725856![]() | O=C1NC(=O)NC(=O)C1(C(CC)C)CC | 0.73 |
MMs01725655![]() | O=C(NC(=O)N)C(C(CC)C)CC | 0.71 |
MMs01725653![]() | O=C(NC(=O)N)C(C(CC)C)CC | 0.71 |
MMs01725652![]() | O=C(NC(=O)N)C(C(CC)C)CC | 0.71 |
MMs01725654![]() | O=C(NC(=O)N)C(C(CC)C)CC | 0.71 |