Drugs present in MMsINC which are similar to the molecule MMscode: MMs00024780
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725953 | S(=O)(=O)(c1ccc(N)cc1S(=O)(=O)NC(=O)C)c1ccc(N)cc1 | 0.79 |
MMs01725656 | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.77 |
MMs01724935 | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.75 |
MMs01724930 | S(=O)(=O)(NC1=NC(=O)N(C=C1)CC)c1ccc(N)cc1 | 0.71 |
MMs01725090 | s1c(nnc1NS(=O)(=O)c1ccc(N)cc1)C | 0.71 |