Drugs present in MMsINC which are similar to the molecule MMscode: MMs00022847
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724743![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.83 |
MMs01725392![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.83 |
MMs01726518![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.83 |
MMs01726519![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.83 |
MMs01725540![]() | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.75 |
MMs01725542![]() | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.75 |
MMs01725118![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)CCN1CCCCC1 | 0.71 |
MMs01724770![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CCC[N+](C1)(C)C | 0.71 |