Drugs present in MMsINC which are similar to the molecule MMscode: MMs00021340
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726814![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.74 |
MMs01726815![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.74 |
MMs01726816![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.74 |
MMs01726817![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.74 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.74 |