Drugs present in MMsINC which are similar to the molecule MMscode: MMs00017517
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725788 | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.75 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.74 |
MMs01727088 | O1CCCC1CC(Cc1c2c(ccc1)cccc2)C(OCCN(CC)CC)=O | 0.70 |
MMs01727090 | O1CCCC1CC(Cc1c2c(ccc1)cccc2)C(OCCN(CC)CC)=O | 0.70 |
MMs01727092 | O1CCCC1CC(Cc1c2c(ccc1)cccc2)C(OCCN(CC)CC)=O | 0.70 |