Drugs present in MMsINC which are similar to the molecule MMscode: MMs00015186
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725693![]() | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.78 |
MMs01726919![]() | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.78 |
MMs01726920![]() | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.78 |
MMs01726921![]() | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.78 |
MMs01727031![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.75 |
MMs01727033![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.75 |
MMs01727035![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.75 |
MMs01727037![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.75 |