Drugs present in MMsINC which are similar to the molecule MMscode: MMs00013335
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725949![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.73 |
MMs01726669![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.73 |
MMs01726671![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.73 |
MMs01726673![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.73 |
MMs01725309![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |