Drugs present in MMsINC which are similar to the molecule MMscode: MMs00009854
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724880 | ClC(Cl)C(=O)N(C)c1ccc(O)cc1 | 0.76 |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.72 |
MMs01724890 | O=C1N(N(C(=O)C1CC=C(C)C)c1ccccc1)c1ccccc1 | 0.71 |
MMs01725683 | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.71 |
MMs01725685 | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.71 |