Drugs present in MMsINC which are similar to the molecule MMscode: MMs00008379
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727358 | OC1CCC2(C(CC=C3C4CCC(C(CC/C(=C\C)/C(C)C)C)C4(CCC23)C)C1C)C | 0.72 |
MMs01727359 | OC1CCC2(C(CC=C3C4CCC(C(CC/C(=C\C)/C(C)C)C)C4(CCC23)C)C1C)C | 0.72 |
MMs01727360 | OC1CCC2(C(CC=C3C4CCC(C(CC/C(=C\C)/C(C)C)C)C4(CCC23)C)C1C)C | 0.72 |
MMs01727361 | OC1CC2=CCC3C4CCC(C(CCC(C(C)C)CC)C)C4(CCC3C2(CC1)C)C | 0.71 |
MMs01727362 | OC1CC2=CCC3C4CCC(C(CCC(C(C)C)CC)C)C4(CCC3C2(CC1)C)C | 0.71 |
MMs01727363 | OC1CC2=CCC3C4CCC(C(CCC(C(C)C)CC)C)C4(CCC3C2(CC1)C)C | 0.71 |
MMs01727364 | OC1CC2=CCC3C4CCC(C(CCC(C(C)C)CC)C)C4(CCC3C2(CC1)C)C | 0.71 |