Drugs present in MMsINC which are similar to the molecule MMscode: MMs00005303
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.79 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01727451![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01727455![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01727449![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01727453![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01726817![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.71 |
MMs01726816![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.71 |
MMs01726815![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.71 |
MMs01726814![]() | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.71 |
MMs01725547![]() | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.71 |