Drugs present in MMsINC which are similar to the molecule MMscode: MMs00004649
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724846 | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.76 |
MMs01724759 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.71 |
MMs01724797 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.71 |
MMs01725805 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.71 |
MMs01726742 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.71 |
MMs01724741 | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.71 |
MMs01726475 | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.71 |