Drugs present in MMsINC which are similar to the molecule MMscode: MMs00004347
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724846 | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.79 |
MMs01725788 | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.79 |
MMs01724816 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.73 |
MMs01726870 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.70 |
MMs01726871 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.70 |
MMs01726872 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.70 |
MMs01726868 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.70 |
MMs01726869 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.70 |