Drugs present in MMsINC which are similar to the molecule MMscode: MMs00003652
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.77 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.71 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.71 |
MMs01725372 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01727222 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01724917 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01727220 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |