Drugs present in MMsINC which are similar to the molecule MMscode: MMs00002567
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 1.00 |
MMs01725108![]() | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.91 |
MMs01725448![]() | Oc1cc(ccc1O)CC(N)C(O)=O | 0.86 |
MMs01727171![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01727173![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01725130![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01727169![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01725376![]() | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.72 |
MMs01725077![]() | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.71 |
MMs01725409![]() | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.70 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |
MMs01724814![]() | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.70 |