Type: Neutral
Formula: C20H23ClN6O
SMILES: |
Clc1cc2c([nH]cc2CCN/C(=N\C(=O)CC)/Nc2nc(cc(n2)C)C)cc1 |
InChI: |
InChI=1/C20H23ClN6O/c1-4-18(28)26-19(27-20-24-12(2)9-13(3)25-20)22-8-7-14-11-23-17-6-5-15(21)10-16(14)17/h5-6,9-11,23H,4,7-8H2,1-3H3,(H2,22,24,25,26,27,28) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 398.898 g/mol | logS: -5.10434 | SlogP: 3.76491 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0745984 | Sterimol/B1: 2.00977 | Sterimol/B2: 4.53667 | Sterimol/B3: 5.51269 |
Sterimol/B4: 11.7616 | Sterimol/L: 17.0241 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 696.385 | Positive charged surface: 430.549 | Negative charged surface: 262.087 | Volume: 378 |
Hydrophobic surface: 544.031 | Hydrophilic surface: 152.354 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |