Type: Neutral
Formula: C21H30O3
SMILES: |
OC1(CCC2C3C(CCC12C)C1(C(=CC(=O)CC1)C(=O)C3)C)CC |
InChI: |
InChI=1/C21H30O3/c1-4-21(24)10-7-16-14-12-18(23)17-11-13(22)5-8-19(17,2)15(14)6-9-20(16,21)3/h11,14-16,24H,4-10,12H2,1-3H3/t14-,15+,16+,19+,20-,21-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 330.468 g/mol | logS: -3.86883 | SlogP: 3.8384 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.281611 | Sterimol/B1: 2.48753 | Sterimol/B2: 2.94509 | Sterimol/B3: 5.18141 |
Sterimol/B4: 7.57019 | Sterimol/L: 12.7169 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 521.124 | Positive charged surface: 340.477 | Negative charged surface: 180.646 | Volume: 332.625 |
Hydrophobic surface: 361.886 | Hydrophilic surface: 159.238 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |