Type: Neutral
Formula: C23H20N6O4
SMILES: |
O(CCCCC)c1ccc([N+](=O)[O-])cc1C(=O)NC1=Nc2n(C=C1C#N)c1c(n2)c
ccc1 |
InChI: |
InChI=1/C23H20N6O4/c1-2-3-6-11-33-20-10-9-16(29(31)32)12-17(20)22(30)26-21-15(13-24)14-28-19-8-5-4-7-18(19)25-23(28)27-21/h4-5,7-10,12,14H,2-3,6,11H2,1H3,(H,25,26,27,30) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 444.451 g/mol | logS: -7.9608 | SlogP: 4.35158 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0069241 | Sterimol/B1: 2.37769 | Sterimol/B2: 2.38577 | Sterimol/B3: 2.5731 |
Sterimol/B4: 12.8963 | Sterimol/L: 18.696 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 741.943 | Positive charged surface: 403.313 | Negative charged surface: 338.631 | Volume: 404 |
Hydrophobic surface: 479.727 | Hydrophilic surface: 262.216 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |