 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1)C1N(CCC1)C(=O) C(NC(=O)C(NC(=O)CCC(=O)[O-])C)C |
| InChI: | InChI=1/C30H36N6O9/c1-18(31-25(37)14-15-26(38)39)27(40)32-19(2)30(43)35-16-6-9-24(35)29(42)34-23(17-20-7-4-3-5-8-20)28(41)33-21-10-12-22(13-11-21)36(44)45/h3-5,7-8,10-13,18-19,23-24H,6,9,14-17H2,1-2H3,(H,31,37)(H,32,40)(H,33,41)(H,34,42)(H,38,39)/p-1/t18-,19+,23-,24+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=121.31 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 623.643 g/mol | logS: -6.01779 | SlogP: -0.20873 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0673283 | Sterimol/B1: 3.30589 | Sterimol/B2: 6.8485 | Sterimol/B3: 6.96561 | |||
| Sterimol/B4: 9.17895 | Sterimol/L: 25.2451 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 976.908 | Positive charged surface: 552.027 | Negative charged surface: 424.881 | Volume: 569.5 | |||
| Hydrophobic surface: 608.697 | Hydrophilic surface: 368.211 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
